C18H28BrN5O — CID 111239913
2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-butoxypropyl)-3-ethylguanidine (PubChem CID 111239913) has the molecular formula C18H28BrN5O and a molecular weight of 410.36 g/mol. Its IUPAC name is 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-butoxypropyl)-3-ethylguanidine.
| Compound Name | 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-butoxypropyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111239913 |
| Molecular Formula | C18H28BrN5O |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-butoxypropyl)-3-ethylguanidine |
| SMILES | CCCCOCCCN/C(=N/Cc1cn2cc(Br)ccc2n1)NCC |
| InChI | InChI=1S/C18H28BrN5O/c1-3-5-10-25-11-6-9-21-18(20-4-2)22-12-16-14-24-13-15(19)7-8-17(24)23-16/h7-8,13-14H,3-6,9-12H2,1-2H3,(H2,20,21,22) |
| InChIKey | BUTXSZPMBDHRPO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 62.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|