C16H24BrN5O — CID 111223669
2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-ethoxypropyl)-3-ethylguanidine (PubChem CID 111223669) has the molecular formula C16H24BrN5O and a molecular weight of 382.31 g/mol. Its IUPAC name is 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-ethoxypropyl)-3-ethylguanidine.
| Compound Name | 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-ethoxypropyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111223669 |
| Molecular Formula | C16H24BrN5O |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-(3-ethoxypropyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cn2cc(Br)ccc2n1)NCCCOCC |
| InChI | InChI=1S/C16H24BrN5O/c1-3-18-16(19-8-5-9-23-4-2)20-10-14-12-22-11-13(17)6-7-15(22)21-14/h6-7,11-12H,3-5,8-10H2,1-2H3,(H2,18,19,20) |
| InChIKey | CMWJLCAWQPPDLJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 62.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|