C17H28ClIN4O — CID 111131429
3-[[N'-[(4-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide (PubChem CID 111131429) has the molecular formula C17H28ClIN4O and a molecular weight of 466.80 g/mol. Its IUPAC name is 3-[[N'-[(4-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide.
| Compound Name | 3-[[N'-[(4-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111131429 |
| Molecular Formula | C17H28ClIN4O |
| Molecular Weight | 466.80 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 3-[[N'-[(4-chlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1)NCCC(=O)N(CC)CC.I |
| InChI | InChI=1S/C17H27ClN4O.HI/c1-4-19-17(20-12-11-16(23)22(5-2)6-3)21-13-14-7-9-15(18)10-8-14;/h7-10H,4-6,11-13H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | IAQCDMLYNNNPBI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.80 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|