C22H39IN4O3 — CID 111941644
3-[[N'-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide (PubChem CID 111941644) has the molecular formula C22H39IN4O3 and a molecular weight of 534.48 g/mol. Its IUPAC name is 3-[[N'-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide.
| Compound Name | 3-[[N'-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111941644 |
| Molecular Formula | C22H39IN4O3 |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | 3-[[N'-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(COCCOCC)c1)NCCC(=O)N(CC)CC.I |
| InChI | InChI=1S/C22H38N4O3.HI/c1-5-23-22(24-13-12-21(27)26(6-2)7-3)25-17-19-10-9-11-20(16-19)18-29-15-14-28-8-4;/h9-11,16H,5-8,12-15,17-18H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | WAQLTBIHCZLCGM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|