C21H33IN6O — CID 111941550
N,N-diethyl-3-[[N-ethyl-N'-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111941550) has the molecular formula C21H33IN6O and a molecular weight of 512.44 g/mol. Its IUPAC name is N,N-diethyl-3-[[N-ethyl-N'-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N,N-diethyl-3-[[N-ethyl-N'-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111941550 |
| Molecular Formula | C21H33IN6O |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | N,N-diethyl-3-[[N-ethyl-N'-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(Cn2cccn2)c1)NCCC(=O)N(CC)CC.I |
| InChI | InChI=1S/C21H32N6O.HI/c1-4-22-21(23-13-11-20(28)26(5-2)6-3)24-16-18-9-7-10-19(15-18)17-27-14-8-12-25-27;/h7-10,12,14-15H,4-6,11,13,16-17H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | VNLJSEKJWLYFKJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|