C22H37N5O2 — CID 111942345
N-tert-butyl-3-[[[[[3-(diethylamino)-3-oxopropyl]amino]-(ethylamino)methylidene]amino]methyl]benzamide (PubChem CID 111942345) has the molecular formula C22H37N5O2 and a molecular weight of 403.57 g/mol. Its IUPAC name is N-tert-butyl-3-[[[[[3-(diethylamino)-3-oxopropyl]amino]-(ethylamino)methylidene]amino]methyl]benzamide.
| Compound Name | N-tert-butyl-3-[[[[[3-(diethylamino)-3-oxopropyl]amino]-(ethylamino)methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111942345 |
| Molecular Formula | C22H37N5O2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.29 |
| IUPAC Name | N-tert-butyl-3-[[[[[3-(diethylamino)-3-oxopropyl]amino]-(ethylamino)methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC(C)(C)C)c1)NCCC(=O)N(CC)CC |
| InChI | InChI=1S/C22H37N5O2/c1-7-23-21(24-14-13-19(28)27(8-2)9-3)25-16-17-11-10-12-18(15-17)20(29)26-22(4,5)6/h10-12,15H,7-9,13-14,16H2,1-6H3,(H,26,29)(H2,23,24,25) |
| InChIKey | NCQCYPORJMDUTK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|