C15H20BrN5 — CID 110992695
1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-cyclopentyl-2-methylguanidine (PubChem CID 110992695) has the molecular formula C15H20BrN5 and a molecular weight of 350.26 g/mol. Its IUPAC name is 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-cyclopentyl-2-methylguanidine.
| Compound Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-cyclopentyl-2-methylguanidine |
|---|---|
| PubChem CID | 110992695 |
| Molecular Formula | C15H20BrN5 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-cyclopentyl-2-methylguanidine |
| SMILES | C/N=C(\NCc1cn2cc(Br)ccc2n1)NC1CCCC1 |
| InChI | InChI=1S/C15H20BrN5/c1-17-15(20-12-4-2-3-5-12)18-8-13-10-21-9-11(16)6-7-14(21)19-13/h6-7,9-10,12H,2-5,8H2,1H3,(H2,17,18,20) |
| InChIKey | VWFVPZAFEVYGDJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|