C18H26BrN5O2 — CID 111409649
1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine (PubChem CID 111409649) has the molecular formula C18H26BrN5O2 and a molecular weight of 424.34 g/mol. Its IUPAC name is 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine.
| Compound Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111409649 |
| Molecular Formula | C18H26BrN5O2 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
| SMILES | C/N=C(\NCCCOCC1CCCO1)NCc1cn2cc(Br)ccc2n1 |
| InChI | InChI=1S/C18H26BrN5O2/c1-20-18(21-7-3-8-25-13-16-4-2-9-26-16)22-10-15-12-24-11-14(19)5-6-17(24)23-15/h5-6,11-12,16H,2-4,7-10,13H2,1H3,(H2,20,21,22) |
| InChIKey | ILKKDUJVTONQHH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|