C19H30IN5O2 — CID 111408110
1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111408110) has the molecular formula C19H30IN5O2 and a molecular weight of 487.39 g/mol. Its IUPAC name is 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111408110 |
| Molecular Formula | C19H30IN5O2 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CCCO1)NCCc1cn2ccccc2n1.I |
| InChI | InChI=1S/C19H29N5O2.HI/c1-20-19(21-9-5-12-25-15-17-6-4-13-26-17)22-10-8-16-14-24-11-3-2-7-18(24)23-16;/h2-3,7,11,14,17H,4-6,8-10,12-13,15H2,1H3,(H2,20,21,22);1H |
| InChIKey | XSWZILDURWAZKG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|