C12H18IN5 — CID 110914604
1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2,3-dimethylguanidine;hydroiodide (PubChem CID 110914604) has the molecular formula C12H18IN5 and a molecular weight of 359.22 g/mol. Its IUPAC name is 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2,3-dimethylguanidine;hydroiodide.
| Compound Name | 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2,3-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110914604 |
| Molecular Formula | C12H18IN5 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2,3-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NC)NCCc1cn2ccccc2n1.I |
| InChI | InChI=1S/C12H17N5.HI/c1-13-12(14-2)15-7-6-10-9-17-8-4-3-5-11(17)16-10;/h3-5,8-9H,6-7H2,1-2H3,(H2,13,14,15);1H |
| InChIKey | AACMMPNOHBHOOW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|