C14H18IN5 — CID 119148965
1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methyl-3-prop-2-ynylguanidine;hydroiodide (PubChem CID 119148965) has the molecular formula C14H18IN5 and a molecular weight of 383.24 g/mol. Its IUPAC name is 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methyl-3-prop-2-ynylguanidine;hydroiodide.
| Compound Name | 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methyl-3-prop-2-ynylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119148965 |
| Molecular Formula | C14H18IN5 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methyl-3-prop-2-ynylguanidine;hydroiodide |
| SMILES | C#CCN/C(=N\C)NCCc1cn2ccccc2n1.I |
| InChI | InChI=1S/C14H17N5.HI/c1-3-8-16-14(15-2)17-9-7-12-11-19-10-5-4-6-13(19)18-12;/h1,4-6,10-11H,7-9H2,2H3,(H2,15,16,17);1H |
| InChIKey | NBWPCUJUNNIDAJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|