C17H26N6O — CID 111040218
1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methyl-3-(2-morpholin-4-ylethyl)guanidine (PubChem CID 111040218) has the molecular formula C17H26N6O and a molecular weight of 330.44 g/mol. Its IUPAC name is 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methyl-3-(2-morpholin-4-ylethyl)guanidine.
| Compound Name | 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methyl-3-(2-morpholin-4-ylethyl)guanidine |
|---|---|
| PubChem CID | 111040218 |
| Molecular Formula | C17H26N6O |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methyl-3-(2-morpholin-4-ylethyl)guanidine |
| SMILES | C/N=C(/NCCc1cn2ccccc2n1)NCCN1CCOCC1 |
| InChI | InChI=1S/C17H26N6O/c1-18-17(20-7-9-22-10-12-24-13-11-22)19-6-5-15-14-23-8-3-2-4-16(23)21-15/h2-4,8,14H,5-7,9-13H2,1H3,(H2,18,19,20) |
| InChIKey | UHKFSYZEQCWHAK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 66.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|