C18H20FN5 — CID 111232571
1-[(4-fluorophenyl)methyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine (PubChem CID 111232571) has the molecular formula C18H20FN5 and a molecular weight of 325.39 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111232571 |
| Molecular Formula | C18H20FN5 |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine |
| SMILES | C/N=C(/NCCc1cn2ccccc2n1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H20FN5/c1-20-18(22-12-14-5-7-15(19)8-6-14)21-10-9-16-13-24-11-3-2-4-17(24)23-16/h2-8,11,13H,9-10,12H2,1H3,(H2,20,21,22) |
| InChIKey | REQZCNHXOZKHJG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|