C20H24FN5S — CID 111311278
1-[3-(4-fluorophenyl)sulfanylpropyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine (PubChem CID 111311278) has the molecular formula C20H24FN5S and a molecular weight of 385.51 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)sulfanylpropyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine.
| Compound Name | 1-[3-(4-fluorophenyl)sulfanylpropyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111311278 |
| Molecular Formula | C20H24FN5S |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 1-[3-(4-fluorophenyl)sulfanylpropyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine |
| SMILES | C/N=C(\NCCCSc1ccc(F)cc1)NCCc1cn2ccccc2n1 |
| InChI | InChI=1S/C20H24FN5S/c1-22-20(23-11-4-14-27-18-8-6-16(21)7-9-18)24-12-10-17-15-26-13-3-2-5-19(26)25-17/h2-3,5-9,13,15H,4,10-12,14H2,1H3,(H2,22,23,24) |
| InChIKey | XKRJVHNALBFKJK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|