C22H30IN5O — CID 111403106
1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methyl-3-[3-(1-phenylethoxy)propyl]guanidine;hydroiodide (PubChem CID 111403106) has the molecular formula C22H30IN5O and a molecular weight of 507.42 g/mol. Its IUPAC name is 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methyl-3-[3-(1-phenylethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methyl-3-[3-(1-phenylethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111403106 |
| Molecular Formula | C22H30IN5O |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methyl-3-[3-(1-phenylethoxy)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOC(C)c1ccccc1)NCCc1cn2ccccc2n1.I |
| InChI | InChI=1S/C22H29N5O.HI/c1-18(19-9-4-3-5-10-19)28-16-8-13-24-22(23-2)25-14-12-20-17-27-15-7-6-11-21(27)26-20;/h3-7,9-11,15,17-18H,8,12-14,16H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | ZUKBSPLFZBLSCN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 62.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|