C14H22IN5O — CID 110941621
1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-3-(2-methoxyethyl)-2-methylguanidine;hydroiodide (PubChem CID 110941621) has the molecular formula C14H22IN5O and a molecular weight of 403.27 g/mol. Its IUPAC name is 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-3-(2-methoxyethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-3-(2-methoxyethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110941621 |
| Molecular Formula | C14H22IN5O |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-3-(2-methoxyethyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCOC)NCCc1cn2ccccc2n1.I |
| InChI | InChI=1S/C14H21N5O.HI/c1-15-14(17-8-10-20-2)16-7-6-12-11-19-9-4-3-5-13(19)18-12;/h3-5,9,11H,6-8,10H2,1-2H3,(H2,15,16,17);1H |
| InChIKey | HEUVNBNDTIEYPQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 62.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|