C19H22ClN5 — CID 111882473
1-[2-(2-chlorophenyl)ethyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine (PubChem CID 111882473) has the molecular formula C19H22ClN5 and a molecular weight of 355.87 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)ethyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine.
| Compound Name | 1-[2-(2-chlorophenyl)ethyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111882473 |
| Molecular Formula | C19H22ClN5 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 1-[2-(2-chlorophenyl)ethyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine |
| SMILES | C/N=C(/NCCc1cn2ccccc2n1)NCCc1ccccc1Cl |
| InChI | InChI=1S/C19H22ClN5/c1-21-19(22-11-9-15-6-2-3-7-17(15)20)23-12-10-16-14-25-13-5-4-8-18(25)24-16/h2-8,13-14H,9-12H2,1H3,(H2,21,22,23) |
| InChIKey | AQARGVJGRPHNNS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|