C21H27N5O2 — CID 111682608
1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-3-[2-(2-methoxyphenoxy)propyl]-2-methylguanidine (PubChem CID 111682608) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-3-[2-(2-methoxyphenoxy)propyl]-2-methylguanidine.
| Compound Name | 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-3-[2-(2-methoxyphenoxy)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111682608 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 1-(2-imidazo[1,2-a]pyridin-2-ylethyl)-3-[2-(2-methoxyphenoxy)propyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1cn2ccccc2n1)NCC(C)Oc1ccccc1OC |
| InChI | InChI=1S/C21H27N5O2/c1-16(28-19-9-5-4-8-18(19)27-3)14-24-21(22-2)23-12-11-17-15-26-13-7-6-10-20(26)25-17/h4-10,13,15-16H,11-12,14H2,1-3H3,(H2,22,23,24) |
| InChIKey | KCBPPMBCGGJEOY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|