C20H25BrIN5O2 — CID 111683205
1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[2-(2-methoxyphenoxy)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111683205) has the molecular formula C20H25BrIN5O2 and a molecular weight of 574.26 g/mol. Its IUPAC name is 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[2-(2-methoxyphenoxy)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[2-(2-methoxyphenoxy)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111683205 |
| Molecular Formula | C20H25BrIN5O2 |
| Molecular Weight | 574.26 g/mol |
| Exact Mass | 573.02 |
| IUPAC Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[2-(2-methoxyphenoxy)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cn2cc(Br)ccc2n1)NCC(C)Oc1ccccc1OC.I |
| InChI | InChI=1S/C20H24BrN5O2.HI/c1-14(28-18-7-5-4-6-17(18)27-3)10-23-20(22-2)24-11-16-13-26-12-15(21)8-9-19(26)25-16;/h4-9,12-14H,10-11H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | HIOFZKLRQHGBHW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.26 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|