C18H18BrF2N5O — CID 111865712
1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[[2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine (PubChem CID 111865712) has the molecular formula C18H18BrF2N5O and a molecular weight of 438.28 g/mol. Its IUPAC name is 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[[2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[[2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111865712 |
| Molecular Formula | C18H18BrF2N5O |
| Molecular Weight | 438.28 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[[2-(difluoromethoxy)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1cn2cc(Br)ccc2n1)NCc1ccccc1OC(F)F |
| InChI | InChI=1S/C18H18BrF2N5O/c1-22-18(23-8-12-4-2-3-5-15(12)27-17(20)21)24-9-14-11-26-10-13(19)6-7-16(26)25-14/h2-7,10-11,17H,8-9H2,1H3,(H2,22,23,24) |
| InChIKey | GKPAXFPXTRIETA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 62.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|