C17H17BrFN5 — CID 111265567
1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[(2-fluorophenyl)methyl]-2-methylguanidine (PubChem CID 111265567) has the molecular formula C17H17BrFN5 and a molecular weight of 390.26 g/mol. Its IUPAC name is 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[(2-fluorophenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[(2-fluorophenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111265567 |
| Molecular Formula | C17H17BrFN5 |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[(2-fluorophenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1cn2cc(Br)ccc2n1)NCc1ccccc1F |
| InChI | InChI=1S/C17H17BrFN5/c1-20-17(21-8-12-4-2-3-5-15(12)19)22-9-14-11-24-10-13(18)6-7-16(24)23-14/h2-7,10-11H,8-9H2,1H3,(H2,20,21,22) |
| InChIKey | OHTWZDUUBNRPBJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|