C15H17BrIN5S — CID 111939954
1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111939954) has the molecular formula C15H17BrIN5S and a molecular weight of 506.21 g/mol. Its IUPAC name is 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111939954 |
| Molecular Formula | C15H17BrIN5S |
| Molecular Weight | 506.21 g/mol |
| Exact Mass | 504.94 |
| IUPAC Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccsc1)NCc1cn2cc(Br)ccc2n1.I |
| InChI | InChI=1S/C15H16BrN5S.HI/c1-17-15(18-6-11-4-5-22-10-11)19-7-13-9-21-8-12(16)2-3-14(21)20-13;/h2-5,8-10H,6-7H2,1H3,(H2,17,18,19);1H |
| InChIKey | ZZJYWWZKABEYJC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.21 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|