C16H19BrIN5S — CID 111351221
1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111351221) has the molecular formula C16H19BrIN5S and a molecular weight of 520.24 g/mol. Its IUPAC name is 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111351221 |
| Molecular Formula | C16H19BrIN5S |
| Molecular Weight | 520.24 g/mol |
| Exact Mass | 518.96 |
| IUPAC Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1cccs1)NCc1cn2cc(Br)ccc2n1.I |
| InChI | InChI=1S/C16H18BrN5S.HI/c1-18-16(19-7-6-14-3-2-8-23-14)20-9-13-11-22-10-12(17)4-5-15(22)21-13;/h2-5,8,10-11H,6-7,9H2,1H3,(H2,18,19,20);1H |
| InChIKey | OYKFUVZSHOSKQB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|