C19H20BrN5O2 — CID 111270513
1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-methylguanidine (PubChem CID 111270513) has the molecular formula C19H20BrN5O2 and a molecular weight of 430.31 g/mol. Its IUPAC name is 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-methylguanidine.
| Compound Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111270513 |
| Molecular Formula | C19H20BrN5O2 |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-2-methylguanidine |
| SMILES | C/N=C(\NCc1cn2cc(Br)ccc2n1)NCC1COc2ccccc2O1 |
| InChI | InChI=1S/C19H20BrN5O2/c1-21-19(22-8-14-11-25-10-13(20)6-7-18(25)24-14)23-9-15-12-26-16-4-2-3-5-17(16)27-15/h2-7,10-11,15H,8-9,12H2,1H3,(H2,21,22,23) |
| InChIKey | SCUUUOXJPVFTIU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|