C16H19BrN6S — CID 111933251
1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 111933251) has the molecular formula C16H19BrN6S and a molecular weight of 407.34 g/mol. Its IUPAC name is 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111933251 |
| Molecular Formula | C16H19BrN6S |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-2-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCc1csc(C)n1)NCc1cn2cc(Br)ccc2n1 |
| InChI | InChI=1S/C16H19BrN6S/c1-11-21-13(10-24-11)5-6-19-16(18-2)20-7-14-9-23-8-12(17)3-4-15(23)22-14/h3-4,8-10H,5-7H2,1-2H3,(H2,18,19,20) |
| InChIKey | FEMYDSLEMITZKQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|