C20H21BrFN5 — CID 111639338
1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methylguanidine (PubChem CID 111639338) has the molecular formula C20H21BrFN5 and a molecular weight of 430.33 g/mol. Its IUPAC name is 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methylguanidine.
| Compound Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111639338 |
| Molecular Formula | C20H21BrFN5 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 1-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-3-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1cn2cc(Br)ccc2n1)NCC1(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C20H21BrFN5/c1-23-19(24-10-17-12-27-11-15(21)5-6-18(27)26-17)25-13-20(7-8-20)14-3-2-4-16(22)9-14/h2-6,9,11-12H,7-8,10,13H2,1H3,(H2,23,24,25) |
| InChIKey | DEYXRCWKPQXHGY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|