C18H21ClIN5S — CID 111639665
1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine;hydroiodide (PubChem CID 111639665) has the molecular formula C18H21ClIN5S and a molecular weight of 501.83 g/mol. Its IUPAC name is 1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111639665 |
| Molecular Formula | C18H21ClIN5S |
| Molecular Weight | 501.83 g/mol |
| Exact Mass | 501.03 |
| IUPAC Name | 1-[[1-(3-chlorophenyl)cyclopropyl]methyl]-3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cn2ccsc2n1)NCC1(c2cccc(Cl)c2)CC1.I |
| InChI | InChI=1S/C18H20ClN5S.HI/c1-20-16(21-10-15-11-24-7-8-25-17(24)23-15)22-12-18(5-6-18)13-3-2-4-14(19)9-13;/h2-4,7-9,11H,5-6,10,12H2,1H3,(H2,20,21,22);1H |
| InChIKey | XKCKUJJFQHURPS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.83 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|