C23H33IN6 — CID 111011074
1-[2-(diethylamino)-2-phenylethyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine;hydroiodide (PubChem CID 111011074) has the molecular formula C23H33IN6 and a molecular weight of 520.46 g/mol. Its IUPAC name is 1-[2-(diethylamino)-2-phenylethyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(diethylamino)-2-phenylethyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111011074 |
| Molecular Formula | C23H33IN6 |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 1-[2-(diethylamino)-2-phenylethyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine;hydroiodide |
| SMILES | CCN(CC)C(CN/C(=N\C)NCCc1cn2ccccc2n1)c1ccccc1.I |
| InChI | InChI=1S/C23H32N6.HI/c1-4-28(5-2)21(19-11-7-6-8-12-19)17-26-23(24-3)25-15-14-20-18-29-16-10-9-13-22(29)27-20;/h6-13,16,18,21H,4-5,14-15,17H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | SRHOZWCMRXCAAK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 56.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|