C21H28IN5 — CID 111342720
1-ethyl-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-(2-phenylpropyl)guanidine;hydroiodide (PubChem CID 111342720) has the molecular formula C21H28IN5 and a molecular weight of 477.39 g/mol. Its IUPAC name is 1-ethyl-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-(2-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-(2-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111342720 |
| Molecular Formula | C21H28IN5 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 1-ethyl-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-(2-phenylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)c1ccccc1)NCCc1cn2ccccc2n1.I |
| InChI | InChI=1S/C21H27N5.HI/c1-3-22-21(24-15-17(2)18-9-5-4-6-10-18)23-13-12-19-16-26-14-8-7-11-20(26)25-19;/h4-11,14,16-17H,3,12-13,15H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | IQVXHDWNUOETAM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|