C18H26IN7 — CID 111903884
1-ethyl-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111903884) has the molecular formula C18H26IN7 and a molecular weight of 467.36 g/mol. Its IUPAC name is 1-ethyl-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111903884 |
| Molecular Formula | C18H26IN7 |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 1-ethyl-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCn1cccn1)NCCc1cn2ccccc2n1.I |
| InChI | InChI=1S/C18H25N7.HI/c1-2-19-18(20-9-5-13-25-14-6-10-22-25)21-11-8-16-15-24-12-4-3-7-17(24)23-16;/h3-4,6-7,10,12,14-15H,2,5,8-9,11,13H2,1H3,(H2,19,20,21);1H |
| InChIKey | ICWWHCCOVYNYSB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|