C18H24N6S — CID 111933602
1-ethyl-2-(2-imidazo[1,2-a]pyridin-2-ylethyl)-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 111933602) has the molecular formula C18H24N6S and a molecular weight of 356.50 g/mol. Its IUPAC name is 1-ethyl-2-(2-imidazo[1,2-a]pyridin-2-ylethyl)-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-(2-imidazo[1,2-a]pyridin-2-ylethyl)-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111933602 |
| Molecular Formula | C18H24N6S |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 1-ethyl-2-(2-imidazo[1,2-a]pyridin-2-ylethyl)-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1cn2ccccc2n1)NCCc1csc(C)n1 |
| InChI | InChI=1S/C18H24N6S/c1-3-19-18(21-10-8-16-13-25-14(2)22-16)20-9-7-15-12-24-11-5-4-6-17(24)23-15/h4-6,11-13H,3,7-10H2,1-2H3,(H2,19,20,21) |
| InChIKey | MVORQVCMGSGSEW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|