C19H27IN6S — CID 111531620
1-ethyl-2-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111531620) has the molecular formula C19H27IN6S and a molecular weight of 498.44 g/mol. Its IUPAC name is 1-ethyl-2-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111531620 |
| Molecular Formula | C19H27IN6S |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 1-ethyl-2-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ncc(CC)s1)NCCc1cn2ccccc2n1.I |
| InChI | InChI=1S/C19H26N6S.HI/c1-3-16-13-23-18(26-16)9-11-22-19(20-4-2)21-10-8-15-14-25-12-6-5-7-17(25)24-15;/h5-7,12-14H,3-4,8-11H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | CTSXJSZMCJWCBK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|