C17H27N5S2 — CID 111533417
1-ethyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine (PubChem CID 111533417) has the molecular formula C17H27N5S2 and a molecular weight of 365.57 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111533417 |
| Molecular Formula | C17H27N5S2 |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-ethyl-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1ncc(CC)s1)NCCc1csc(CC)n1 |
| InChI | InChI=1S/C17H27N5S2/c1-4-14-11-21-16(24-14)8-10-20-17(18-6-3)19-9-7-13-12-23-15(5-2)22-13/h11-12H,4-10H2,1-3H3,(H2,18,19,20) |
| InChIKey | ZELDDJDCRLUISU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|