C16H30IN5OS — CID 111533482
N-[2-[[N-ethyl-N'-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]carbamimidoyl]amino]ethyl]-2-methylpropanamide;hydroiodide (PubChem CID 111533482) has the molecular formula C16H30IN5OS and a molecular weight of 467.42 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]carbamimidoyl]amino]ethyl]-2-methylpropanamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]carbamimidoyl]amino]ethyl]-2-methylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111533482 |
| Molecular Formula | C16H30IN5OS |
| Molecular Weight | 467.42 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]carbamimidoyl]amino]ethyl]-2-methylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1ncc(CC)s1)NCCNC(=O)C(C)C.I |
| InChI | InChI=1S/C16H29N5OS.HI/c1-5-13-11-21-14(23-13)7-8-19-16(17-6-2)20-10-9-18-15(22)12(3)4;/h11-12H,5-10H2,1-4H3,(H,18,22)(H2,17,19,20);1H |
| InChIKey | XEFBCBHSTQYCEW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|