C14H26N4O2S2 — CID 111531261
1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-(3-methylsulfonylpropyl)guanidine (PubChem CID 111531261) has the molecular formula C14H26N4O2S2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-(3-methylsulfonylpropyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-(3-methylsulfonylpropyl)guanidine |
|---|---|
| PubChem CID | 111531261 |
| Molecular Formula | C14H26N4O2S2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-(3-methylsulfonylpropyl)guanidine |
| SMILES | CCN/C(=N\CCCS(C)(=O)=O)NCCc1ncc(CC)s1 |
| InChI | InChI=1S/C14H26N4O2S2/c1-4-12-11-18-13(21-12)7-9-17-14(15-5-2)16-8-6-10-22(3,19)20/h11H,4-10H2,1-3H3,(H2,15,16,17) |
| InChIKey | UVIHWRZLIVKBGX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|