C15H26F3IN4OS — CID 111531652
1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide (PubChem CID 111531652) has the molecular formula C15H26F3IN4OS and a molecular weight of 494.37 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111531652 |
| Molecular Formula | C15H26F3IN4OS |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOCC(F)(F)F)NCCc1ncc(CC)s1.I |
| InChI | InChI=1S/C15H25F3N4OS.HI/c1-3-12-10-22-13(24-12)6-8-21-14(19-4-2)20-7-5-9-23-11-15(16,17)18;/h10H,3-9,11H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | RSDKQXXPDVRESV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|