C17H28IN5S2 — CID 111933856
1-ethyl-2-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111933856) has the molecular formula C17H28IN5S2 and a molecular weight of 493.48 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111933856 |
| Molecular Formula | C17H28IN5S2 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 1-ethyl-2-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1nc(CC)c(C)s1)NCCc1csc(C)n1.I |
| InChI | InChI=1S/C17H27N5S2.HI/c1-5-15-12(3)24-16(22-15)8-10-20-17(18-6-2)19-9-7-14-11-23-13(4)21-14;/h11H,5-10H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | YUFFDJHMHKAZEJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|