C19H27FN4S — CID 111362649
1-ethyl-2-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-[2-(2-fluorophenyl)ethyl]guanidine (PubChem CID 111362649) has the molecular formula C19H27FN4S and a molecular weight of 362.52 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-[2-(2-fluorophenyl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-[2-(2-fluorophenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111362649 |
| Molecular Formula | C19H27FN4S |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 1-ethyl-2-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-3-[2-(2-fluorophenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1nc(CC)c(C)s1)NCCc1ccccc1F |
| InChI | InChI=1S/C19H27FN4S/c1-4-17-14(3)25-18(24-17)11-13-23-19(21-5-2)22-12-10-15-8-6-7-9-16(15)20/h6-9H,4-5,10-13H2,1-3H3,(H2,21,22,23) |
| InChIKey | VKKORQNGWNUZAP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|