C16H31IN4S2 — CID 111611727
1-ethyl-3-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide (PubChem CID 111611727) has the molecular formula C16H31IN4S2 and a molecular weight of 470.49 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111611727 |
| Molecular Formula | C16H31IN4S2 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 1-ethyl-3-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)SC)NCCc1nc(CC)c(C)s1.I |
| InChI | InChI=1S/C16H30N4S2.HI/c1-7-13-12(3)22-14(20-13)9-10-18-15(17-8-2)19-11-16(4,5)21-6;/h7-11H2,1-6H3,(H2,17,18,19);1H |
| InChIKey | GUBZTHPEZBWPNJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|