C16H25IN4S2 — CID 111257866
1-ethyl-3-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111257866) has the molecular formula C16H25IN4S2 and a molecular weight of 464.44 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111257866 |
| Molecular Formula | C16H25IN4S2 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 1-ethyl-3-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccs1)NCCc1nc(CC)c(C)s1.I |
| InChI | InChI=1S/C16H24N4S2.HI/c1-4-14-12(3)22-15(20-14)8-9-18-16(17-5-2)19-11-13-7-6-10-21-13;/h6-7,10H,4-5,8-9,11H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | ZBQAXEBGUWULEE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|