C18H28N4OS2 — CID 109418836
1-ethyl-3-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine (PubChem CID 109418836) has the molecular formula C18H28N4OS2 and a molecular weight of 380.58 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 109418836 |
| Molecular Formula | C18H28N4OS2 |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 1-ethyl-3-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCCc1nc(CC)c(C)s1 |
| InChI | InChI=1S/C18H28N4OS2/c1-5-14-13(3)25-16(22-14)9-10-20-17(19-6-2)21-12-18(4,23)15-8-7-11-24-15/h7-8,11,23H,5-6,9-10,12H2,1-4H3,(H2,19,20,21) |
| InChIKey | VJGZPBBYLWXLNV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|