C15H21BrN4S2 — CID 111863283
2-[2-(5-bromothiophen-2-yl)ethyl]-1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 111863283) has the molecular formula C15H21BrN4S2 and a molecular weight of 401.40 g/mol. Its IUPAC name is 2-[2-(5-bromothiophen-2-yl)ethyl]-1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 2-[2-(5-bromothiophen-2-yl)ethyl]-1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111863283 |
| Molecular Formula | C15H21BrN4S2 |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 2-[2-(5-bromothiophen-2-yl)ethyl]-1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1ccc(Br)s1)NCCc1csc(C)n1 |
| InChI | InChI=1S/C15H21BrN4S2/c1-3-17-15(18-8-6-12-10-21-11(2)20-12)19-9-7-13-4-5-14(16)22-13/h4-5,10H,3,6-9H2,1-2H3,(H2,17,18,19) |
| InChIKey | RFEYVTBUEQTYOU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|