C18H29N5S2 — CID 111533375
2-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine (PubChem CID 111533375) has the molecular formula C18H29N5S2 and a molecular weight of 379.60 g/mol. Its IUPAC name is 2-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine.
| Compound Name | 2-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111533375 |
| Molecular Formula | C18H29N5S2 |
| Molecular Weight | 379.60 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1csc(C(C)(C)C)n1)NCCc1ncc(CC)s1 |
| InChI | InChI=1S/C18H29N5S2/c1-6-14-11-21-15(25-14)8-9-20-17(19-7-2)22-10-13-12-24-16(23-13)18(3,4)5/h11-12H,6-10H2,1-5H3,(H2,19,20,22) |
| InChIKey | ARXPEMJEHKVJST-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.60 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|