C18H24IN5OS2 — CID 111532878
1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111532878) has the molecular formula C18H24IN5OS2 and a molecular weight of 517.46 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111532878 |
| Molecular Formula | C18H24IN5OS2 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1coc(-c2cccs2)n1)NCCc1ncc(CC)s1.I |
| InChI | InChI=1S/C18H23N5OS2.HI/c1-3-14-11-21-16(26-14)7-8-20-18(19-4-2)22-10-13-12-24-17(23-13)15-6-5-9-25-15;/h5-6,9,11-12H,3-4,7-8,10H2,1-2H3,(H2,19,20,22);1H |
| InChIKey | IPTZBVDHOGNUEM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|