C16H25IN4OS2 — CID 111611467
1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111611467) has the molecular formula C16H25IN4OS2 and a molecular weight of 480.44 g/mol. Its IUPAC name is 1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111611467 |
| Molecular Formula | C16H25IN4OS2 |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 1-ethyl-3-(2-methyl-2-methylsulfanylpropyl)-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1coc(-c2cccs2)n1)NCC(C)(C)SC.I |
| InChI | InChI=1S/C16H24N4OS2.HI/c1-5-17-15(19-11-16(2,3)22-4)18-9-12-10-21-14(20-12)13-7-6-8-23-13;/h6-8,10H,5,9,11H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | QMBRESCGMNWDMA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|