C19H27IN4OS — CID 111209439
1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111209439) has the molecular formula C19H27IN4OS and a molecular weight of 486.42 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111209439 |
| Molecular Formula | C19H27IN4OS |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1coc(-c2cccs2)n1)NCCC1=CCCCC1.I |
| InChI | InChI=1S/C19H26N4OS.HI/c1-2-20-19(21-11-10-15-7-4-3-5-8-15)22-13-16-14-24-18(23-16)17-9-6-12-25-17;/h6-7,9,12,14H,2-5,8,10-11,13H2,1H3,(H2,20,21,22);1H |
| InChIKey | LLRDVZCCGOOTTB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|