C21H28IN5O2S — CID 111007388
1-ethyl-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111007388) has the molecular formula C21H28IN5O2S and a molecular weight of 541.46 g/mol. Its IUPAC name is 1-ethyl-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111007388 |
| Molecular Formula | C21H28IN5O2S |
| Molecular Weight | 541.46 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | 1-ethyl-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1coc(-c2cccs2)n1)NCC(c1ccco1)N1CCCC1.I |
| InChI | InChI=1S/C21H27N5O2S.HI/c1-2-22-21(23-13-16-15-28-20(25-16)19-8-6-12-29-19)24-14-17(18-7-5-11-27-18)26-9-3-4-10-26;/h5-8,11-12,15,17H,2-4,9-10,13-14H2,1H3,(H2,22,23,24);1H |
| InChIKey | NEBBTOXXCMLVGA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|