C21H33N5O2S — CID 111935463
1-ethyl-3-(4-methyl-2-morpholin-4-ylpentyl)-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine (PubChem CID 111935463) has the molecular formula C21H33N5O2S and a molecular weight of 419.60 g/mol. Its IUPAC name is 1-ethyl-3-(4-methyl-2-morpholin-4-ylpentyl)-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-(4-methyl-2-morpholin-4-ylpentyl)-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111935463 |
| Molecular Formula | C21H33N5O2S |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 1-ethyl-3-(4-methyl-2-morpholin-4-ylpentyl)-2-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1coc(-c2cccs2)n1)NCC(CC(C)C)N1CCOCC1 |
| InChI | InChI=1S/C21H33N5O2S/c1-4-22-21(23-13-17-15-28-20(25-17)19-6-5-11-29-19)24-14-18(12-16(2)3)26-7-9-27-10-8-26/h5-6,11,15-16,18H,4,7-10,12-14H2,1-3H3,(H2,22,23,24) |
| InChIKey | CODZAXDKKKEZOM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|