C17H30IN5S — CID 111964440
1-[2-(cyclohexen-1-yl)ethyl]-2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111964440) has the molecular formula C17H30IN5S and a molecular weight of 463.43 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111964440 |
| Molecular Formula | C17H30IN5S |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1csc(N(C)C)n1)NCCC1=CCCCC1.I |
| InChI | InChI=1S/C17H29N5S.HI/c1-4-18-16(19-11-10-14-8-6-5-7-9-14)20-12-15-13-23-17(21-15)22(2)3;/h8,13H,4-7,9-12H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | MCHRNTHNZXUEGQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|