C17H25FIN5S — CID 111964520
2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-ethyl-3-[2-(4-fluorophenyl)ethyl]guanidine;hydroiodide (PubChem CID 111964520) has the molecular formula C17H25FIN5S and a molecular weight of 477.39 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-ethyl-3-[2-(4-fluorophenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-ethyl-3-[2-(4-fluorophenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111964520 |
| Molecular Formula | C17H25FIN5S |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 2-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-1-ethyl-3-[2-(4-fluorophenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1csc(N(C)C)n1)NCCc1ccc(F)cc1.I |
| InChI | InChI=1S/C17H24FN5S.HI/c1-4-19-16(20-10-9-13-5-7-14(18)8-6-13)21-11-15-12-24-17(22-15)23(2)3;/h5-8,12H,4,9-11H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | CDGKZPUUHNQCCE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|